| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- DMBCB
-
-
2025-06-20
- CAS:10094-34-5
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20tons
|
| | Benzyldimethylcarbinyl butyrate Basic information |
| | Benzyldimethylcarbinyl butyrate Chemical Properties |
| Boiling point | 237-255 °C(lit.) | | density | 0.969 g/mL at 25 °C(lit.) | | vapor pressure | 0.164Pa at 20℃ | | refractive index | n20/D 1.4839(lit.) | | FEMA | 2394 | ALPHA,ALPHA-DIMETHYLPHENETHYL BUTYRATE | | Fp | >230 °F | | Specific Gravity | 0.96 | | color | Colorless liquid | | Odor | plum aroma | | Odor Type | floral | | biological source | synthetic | | Water Solubility | 16.11mg/L at 20℃ | | JECFA Number | 1656 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C14H20O2/c1-4-8-13(15)16-14(2,3)11-12-9-6-5-7-10-12/h5-7,9-10H,4,8,11H2,1-3H3 | | InChIKey | SHSGYHAHMQLYRB-UHFFFAOYSA-N | | SMILES | CCCC(=O)OC(C)(C)Cc1ccccc1 | | LogP | 4.7 at 25℃ | | CAS DataBase Reference | 10094-34-5(CAS DataBase Reference) | | NIST Chemistry Reference | Butanoic acid, 1,1-dimethyl-2-phenylethyl ester(10094-34-5) | | EPA Substance Registry System | Butanoic acid, 1,1-dimethyl-2-phenylethyl ester (10094-34-5) |
| Hazard Codes | Xi,N | | Risk Statements | 38-43-51/53 | | Safety Statements | 36/37-61 | | RIDADR | UN3082 9/PG 3 | | WGK Germany | 2 | | RTECS | ET0130000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 3
Skin Irrit. 2 | | Toxicity | LD50 orl-rat: >5 g/kg FCTXAV 18,667,80 |
| | Benzyldimethylcarbinyl butyrate Usage And Synthesis |
| Chemical Properties | α,α-Dimethylphenylethyl Butyrate is a colorless liquid with a slightly herbal, strongly fruity odor,reminiscent of prune and apricot. It is used in perfumery as a modifier of the
alcohol and for oriental notes. | | Chemical Properties | α,α-Dimethylphenethyl butyrate has a mild, herbaceous, fruity (plum–prune) odor and an apricot-, peach-, plum-like taste | | Uses | Benzyldimethylcarbinyl butyrate is used in perfume compositions of the Oriental-Rose, Chypre, Peony and other types, often as a modifier for other D. M.B.C. esters. | | Definition | ChEBI: 2-Methyl-1-phenyl-2-propanyl butyrate is an alkylbenzene. | | Safety Profile | Low oral toxicity. A skin irritant.When heated to decomposition it emits acrid smoke andirritating fumes. | | Synthesis | Benzyldimethylcarbinyl butyrate is prepared by direct esterification of Dimethyl benzylcarbinol with n-Butyric acid, using a catalyst and preferably azeotropic conditions. |
| | Benzyldimethylcarbinyl butyrate Preparation Products And Raw materials |
|