6-[1-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-naphthalen-2-yl)-cyclopropyl]-nicotinic acid manufacturers
- LG100268
-
-
2026-05-11
- CAS:153559-76-3
- Purity: 99.83%
- Supply Ability: 10g
|
| | 6-[1-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-naphthalen-2-yl)-cyclopropyl]-nicotinic acid Basic information |
| Product Name: | 6-[1-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-naphthalen-2-yl)-cyclopropyl]-nicotinic acid | | Synonyms: | 2-[1-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-2-naphthyl)cyclopropyl]pyridine-5-carboxylic acid;6-[1-(3,5,5,8,8-PentaMethyl-5,6,7,8-tetrahydronaphthalen-2-yl)cyclopropyl]pyridine-3-carboxylic acid;3-Pyridinecarboxylicacid,6-[1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentaMethyl-2-naphthalenyl)cyclopropyl]-;3-pyridinecarboxylicacid,6-(1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-nap;hthalenyl)cyclopropyl)-;6-[1-(3,5,5,8,8-PENTAMETHYL-5,6,7,8-TETRAHYDRO-NAPHTHALEN-2-YL)-CYCLOPROPYL]-NICOTINIC ACID (FOR R&D ONLY);6-[1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)cyclopropyl]- 3-Pyridinecarboxylic Acid;AGN 192620 | | CAS: | 153559-76-3 | | MF: | C24H29NO2 | | MW: | 363.49 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Retinoids | | Mol File: | 153559-76-3.mol | ![6-[1-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-naphthalen-2-yl)-cyclopropyl]-nicotinic acid Structure](CAS/GIF/153559-76-3.gif) |
| | 6-[1-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-naphthalen-2-yl)-cyclopropyl]-nicotinic acid Chemical Properties |
| Melting point | 275-277°C | | Boiling point | 487.0±33.0 °C(Predicted) | | density | 1.115±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: ≥5mg/mL (warmed) | | pka | 2.35±0.10(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C24H29NO2/c1-15-12-18-19(23(4,5)9-8-22(18,2)3)13-17(15)24(10-11-24)20-7-6-16(14-25-20)21(26)27/h6-7,12-14H,8-11H2,1-5H3,(H,26,27) | | InChIKey | SLXTWXQUEZSSTJ-UHFFFAOYSA-N | | SMILES | Cc1cc2c(cc1C3(CC3)c4ccc(cn4)C(O)=O)C(C)(C)CCC2(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 6-[1-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-naphthalen-2-yl)-cyclopropyl]-nicotinic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | LG 100268 is a potent RXR agonist for evaluation in the treatment of non-insulin-dependent (type II) diabetes mellitus (NIDDM). | | Biochem/physiol Actions | LG100268 (LG268) is a potent and selective rexinoid and retinoid-X receptor (RXR) agonist. LG100268 binds to the α, β and γ RXR receptors with an IC50 = 3-4 nM and has no activity at the RAR retinoic acid receptors. | | in vivo | LG100268 (oral diet; 100 mg/kg; once daily; 7 weeks) combines with C/P presents a more markedly reduced average tumor burden than LG268 or C/P alone. The combination establish a reduced lung tumors, which represents a reduction of 82% (vs. 59%-67% with the single drugs) in comparison with the controls[3]. | Animal Model: | A/J mice[3] | | Dosage: | 50 mg/kg (Combines with carboplatin (50 mg/kg i.p.) starts 1 week after the LG268 treatment diet) | | Administration: | Oral diet; once daily; 7 weeks | | Result: | Decreased lung tumors growth significantly in mice. |
| | storage | Store at -20°C |
| | 6-[1-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-naphthalen-2-yl)-cyclopropyl]-nicotinic acid Preparation Products And Raw materials |
|