| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| Product Name: | Nitron | | Synonyms: | 3,5,6-Triphenyl-2,3,5,6-tetraazabicyclo[2.1.1]hex-1-ene, 4,5-Dihydro-2,4-diphenyl-5-(phenylimino)-1H-1,2,4-triazolium hydroxide inner salt, 1,4-Diphenyl-3-phenylamino-1,2,4-triazolium hydroxide inner salt;N,1,4-Triphenyl-4,5-dihydro-1H-1,2,4-triazol-3-amine anion;[2,3-Dihydro-1,4-diphenyl-3-(phenylimino)-1H-1,2,4-triazol-4-ium]-2-ide;N,1,4-Triphenyl-1H-1,2,4-triazol-4-ium-3-amine anion;N-[(2,4-Diphenyl-4H-1,2,4-triazol-2-ium)-5-yl]-N-phenylamine anion;Nitron(analytical reagent);Nitron,95%;Nitron,1,4-Diphenyl-3-phenylamino-1,2,4-triazolium hydroxide inner salt, 3,5,6-Triphenyl-2,3,5,6-tetraazabicyclo[2.1.1]hex-1-ene, 4,5-Dihydro-2,4-diphenyl-5-(phenylimino)-1H-1,2,4-triazolium hydroxide | | CAS: | 2218-94-2 | | MF: | C20H16N4 | | MW: | 312.37 | | EINECS: | 218-724-2 | | Product Categories: | | | Mol File: | 2218-94-2.mol |  |
| | Nitron Chemical Properties |
| Melting point | 189-190 °C (dec.)(lit.) | | Boiling point | 442.29°C (rough estimate) | | density | 1.1872 (rough estimate) | | refractive index | 1.6400 (estimate) | | solubility | almost transparency in Acetic acid | | form | powder to crystal | | pka | 10.34 ± 0.02(at 25℃) | | color | Light yellow to Brown to Dark green | | Merck | 14,6612 | | BRN | 3913543 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C20H16N4/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18/h1-16H | | InChIKey | CWGBFIRHYJNILV-UHFFFAOYSA-N | | SMILES | [N+]1(=CN(C2C=CC=CC=2)[N-]/C/1=N\C1C=CC=CC=1)C1=CC=CC=C1 | | EPA Substance Registry System | 1,4-Diphenyl-3-(phenylamino)-1H-1,2,4-triazolium inner salt (2218-94-2) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids |
| | Nitron Usage And Synthesis |
| Chemical Properties | lemon yellow crystalline powder | | Uses | Determination of boron, nitrate, perchlorate, rhenium, tungsten, molybdenum. | | Purification Methods | Crystallise it from EtOH, chloroform or EtOH/*C6H6. [Beilstein 25 III/IV 1075.] |
| | Nitron Preparation Products And Raw materials |
|