| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2-Fluoro-5-(trifluoromethyl)benzyl alcohol manufacturers
|
| | 2-Fluoro-5-(trifluoromethyl)benzyl alcohol Basic information |
| | 2-Fluoro-5-(trifluoromethyl)benzyl alcohol Chemical Properties |
| Boiling point | 188℃ | | density | 1.377 | | refractive index | 1.4475 | | Fp | 67℃ | | storage temp. | 2-8°C | | form | liquid | | pka | 13.69±0.10(Predicted) | | color | Clear, faint yellow | | InChI | 1S/C8H6F4O/c9-7-2-1-6(8(10,11)12)3-5(7)4-13/h1-3,13H,4H2 | | InChIKey | LFWIVOZRZSAKAL-UHFFFAOYSA-N | | SMILES | FC(F)(F)C1=CC=C(F)C(CO)=C1 | | CAS DataBase Reference | 207974-09-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2906290090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 2-Fluoro-5-(trifluoromethyl)benzyl alcohol Usage And Synthesis |
| Chemical Properties | Colorless transparent liquid |
| | 2-Fluoro-5-(trifluoromethyl)benzyl alcohol Preparation Products And Raw materials |
|