| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | 2,4-Dibromo-6-fluoroaniline Basic information |
| Product Name: | 2,4-Dibromo-6-fluoroaniline | | Synonyms: | 2,4-Dibromo-6-fluoroaniline 98%;2,4-Dibromo-6-fluoroaniline98%;2,4-DIBROMO-6-FLUORO;Benzenamine,2,4-dibromo-6-fluoro-;2,4-Dibromo-6-fL;2,4-DIBROMO-6-FLUOROANILINE ISO 9001：2015 REACH;Tianfu Chem 2,4-DIBROMO-6-FLUOROANILINE;2,4-Dibromo-6-fluoro phenylamine, 98% | | CAS: | 141474-37-5 | | MF: | C6H4Br2FN | | MW: | 268.91 | | EINECS: | | | Product Categories: | Fluorobenzene;Anilines, Aromatic Amines and Nitro Compounds;Anilines, Amides & Amines;Bromine Compounds;Fluorine Compounds | | Mol File: | 141474-37-5.mol |  |
| | 2,4-Dibromo-6-fluoroaniline Chemical Properties |
| Melting point | 59-64 °C(lit.) | | Boiling point | 245.7±35.0 °C(Predicted) | | density | 2.096±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 0.44±0.10(Predicted) | | Appearance | Brown to reddish brown Solid | | BRN | 6289292 | | InChI | InChI=1S/C6H4Br2FN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 | | InChIKey | YJLXEKFYZIBUPJ-UHFFFAOYSA-N | | SMILES | C1(N)=C(F)C=C(Br)C=C1Br | | CAS DataBase Reference | 141474-37-5(CAS DataBase Reference) |
| | 2,4-Dibromo-6-fluoroaniline Usage And Synthesis |
| Uses | 2,4-DIBROMO-6-FLUOROANILINE is used as pharmaceutical, pesticide, and liquid crystal material intermediates. |
| | 2,4-Dibromo-6-fluoroaniline Preparation Products And Raw materials |
|