|
|
| | (S)-1-(4-Nitrophenyl)ethylamine hydrochloride Basic information |
| Product Name: | (S)-1-(4-Nitrophenyl)ethylamine hydrochloride | | Synonyms: | METHYL-4-NITROBENZYLAMINEHYDROCHLORIDE;(R)-4-Nitro-α-methylbenzylamine hydrochloride;Benzenemethanamine, .alpha.-methyl-4-nitro-, monohydrochloride, (.alpha.R)-;(r)-α-methyl-4-nitrobenzylamine hydrochloride;(R)-A-METHYL-4-NITROBENZYLAMINE HYDROCHLORIDE,97%;(R)-(-)-1-(4-NITROPHENYL)-ETHYLAMINE HCL;(R)-1-(4-NITROPHENYL)ETHYLAMINE HYDROCHLORIDE;(R)-4-NITROPHENYL-1-ETHYLAMINE HYDROCHLORIDE | | CAS: | 57233-86-0 | | MF: | C8H11ClN2O2 | | MW: | 202.64 | | EINECS: | | | Product Categories: | | | Mol File: | 57233-86-0.mol |  |
| | (S)-1-(4-Nitrophenyl)ethylamine hydrochloride Chemical Properties |
| Melting point | 248-250 °C(lit.) | | alpha | -6.5 º (c=1, 0.05N NaOH) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | Off-white to yellow Solid | | Optical Rotation | [α]25/D +6.0°, c = 1 in 0.05 M NaOH | | BRN | 3701567 | | InChI | 1S/C8H10N2O2.ClH/c1-6(9)7-2-4-8(5-3-7)10(11)12;/h2-6H,9H2,1H3;1H/t6-;/m1./s1 | | InChIKey | CZQQGVFHLSBEDV-FYZOBXCZSA-N | | SMILES | Cl.C[C@@H](N)c1ccc(cc1)[N+]([O-])=O | | CAS DataBase Reference | 57233-86-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids |
| | (S)-1-(4-Nitrophenyl)ethylamine hydrochloride Usage And Synthesis |
| Purification Methods | To ensure dryness, the hydrochloride (ca 175 g) is extracted with EtOH (3x100mL) and evaporated to dryness (any residual H2O increases the solubility in EtOH and lowers the yield). The hydrochloride residue is triturated with absolute EtOH and dried in vacuo. The product is further purified by refluxing with absolute EtOH (200 mL for 83g) for 1hour, and cool to 10o to give 76.6g of hydrochloride m 243-245o(dec). The free base is prepared by dissolving in N NaOH, extracting with CH2Cl2 (3 x 500mL), drying (Na2CO3), filtering, evaporating and distilling it. It has m 27o, b 119-120o/0.5mm (105-107o/0.5mm, 157-159o/9mm, d 1.1764, n 1.5688, [] ±17.7o (neat) [Perry et al. Synthesis 492 1977,ORD: Nerdel & Liebig Justus Liebigs Ann Chem 621 142 1959]. [Beilstein 12 IV 2451.] |
| | (S)-1-(4-Nitrophenyl)ethylamine hydrochloride Preparation Products And Raw materials |
|