| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
DI-POTASSIUM PHTHALATE manufacturers
|
| | DI-POTASSIUM PHTHALATE Basic information |
| Product Name: | DI-POTASSIUM PHTHALATE | | Synonyms: | DI-POTASSIUM PHTHALATE;DIPOTASSIUM PHTHALATE, 98%DIPOTASSIUM PHTHALATE, 98%DIPOTASSIUM PHTHALATE, 98%DIPOTASSIUM PHTHALATE, 98%;PHTHALIC ACID, DIPOTASSIUM SALT;Phthalic acid dipotassium salt 98%;di-Potassium phthalate for synthesis;DIPOTASSIUM PHTHALATE, 98%,;1,2-Benzenedicarboxylicacid,dipotassiumsalt;1,2-Benzenedicarboxylicacid, potassium | | CAS: | 4409-98-7 | | MF: | C8H4K2O4 | | MW: | 242.31 | | EINECS: | 224-561-8 | | Product Categories: | Carbonyl Compounds;Carboxylic Acid Salts;Organic Building Blocks | | Mol File: | 4409-98-7.mol |  |
| | DI-POTASSIUM PHTHALATE Chemical Properties |
| storage temp. | Store below +30°C. | | solubility | water: soluble25mg/mL, clear, colorless | | form | powder | | Water Solubility | water: soluble 25mg/mL, clear, colorless | | InChI | 1S/C8H6O4.2K/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;/q;2*+1/p-2 | | InChIKey | GOMCKELMLXHYHH-UHFFFAOYSA-L | | SMILES | [K+].[K+].[O-]C(=O)c1c(cccc1)C(=O)[O-] | | EPA Substance Registry System | Dipotassium phthalate (4409-98-7) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | DI-POTASSIUM PHTHALATE Usage And Synthesis |
| Uses | Phthalic acid dipotassium salt may be used in the preparation of brucite-like Ca2+/Al3+ layered double hydroxide (LDH), Ca2Al(OH)6·NO3·2H2O. | | General Description | Phthalic acid dipotassium salt is the dipotassium salt of 1,2-benzenedicarboxylic acid. |
| | DI-POTASSIUM PHTHALATE Preparation Products And Raw materials |
|