| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-Nitrosodiphenylamine (2,2',4,4',6,6'-d6) Basic information |
| Product Name: | N-Nitrosodiphenylamine (2,2',4,4',6,6'-d6) | | Synonyms: | N-NITROSODIPHENYL-2,2',4,4',6'-D6-AMINE&;N-Nitrosodiphenyl-d6-aMine;"N-Nitroso-N-[(2,4,6-D3)phenyl](2,4,6-D3)aniline";Benzen-2,4,6-d3-amine, N-nitroso-N-(phenyl-2,4,6-d3);N-Nitrosodiphenyl-2,2',4,4',6,6'-d6-amine;N-Nitrosodiphenylamine-d6;N-Nitrosodiphenylamine(2,2',4,4',6,6'-d6)Solution in Methylene chloride-d2;N-Nitroso-diphenylamine D6 (2,2',4,4',6,6'-D6) | | CAS: | 93951-95-2 | | MF: | C12H10N2O | | MW: | 198.23 | | EINECS: | | | Product Categories: | Alphabetical Listings;N-O;Stable Isotopes | | Mol File: | 93951-95-2.mol |  |
| | N-Nitrosodiphenylamine (2,2',4,4',6,6'-d6) Chemical Properties |
| Melting point | 65-66 °C (lit.) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | color | Dark Green to Very Dark Green | | Stability: | Light Sensitive | | InChI | 1S/C12H10N2O/c15-13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i1D,2D,7D,8D,9D,10D | | InChIKey | UBUCNCOMADRQHX-MWJWXFQUSA-N | | SMILES | [2H]c1cc([2H])c(c([2H])c1)N(N=O)c2c([2H])cc([2H])cc2[2H] | | EPA Substance Registry System | N-Nitrosodiphenylamine-d6 (93951-95-2) | | CAS Number Unlabeled | 86-30-6 |
| Hazard Codes | Xi,N | | Risk Statements | 36/38-43-51/53 | | Safety Statements | 26-36/37-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 1
Carc. 2
Repr. 2
Skin Sens. 1A
STOT RE 2 |
| | N-Nitrosodiphenylamine (2,2',4,4',6,6'-d6) Usage And Synthesis |
| Uses | N-Nitrosodiphenyl-2,2'',4,4'',6,6''-d6-amine (CAS# 93951-95-2) is a useful isotopically labeled research compound. |
| | N-Nitrosodiphenylamine (2,2',4,4',6,6'-d6) Preparation Products And Raw materials |
|