| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
Salbutamol EP Impurity B HCl manufacturers
|
| | Salbutamol EP Impurity B HCl Basic information |
| Product Name: | Salbutamol EP Impurity B HCl | | Synonyms: | Salbutamol impurity 2/Salbutamol EP Impurity B HCl/α-[[(1,1-Dimethylethyl)amino]methyl]-4-hydroxy-benzenemethanol hydrochloride;Albuterol EP Impurity B TFA;Salbutamol Impurity B HCl;4-(2-(tert-butylamino)-1-hydroxyethyl)phenol hydrochloride;4-(2-(tert-Butylamino)-1-hydroxyethyl)phenol hydrochloride (Salbutamol Impurity);Salbutamol EP Impurity B HCl;4-(2-(tert-butylamino)-1-hydroxyethyl)phenol 2,2,2-trifluoroacetate | | CAS: | 112337-52-7 | | MF: | C12H20ClNO2 | | MW: | 245.75 | | EINECS: | | | Product Categories: | | | Mol File: | 112337-52-7.mol |  |
| | Salbutamol EP Impurity B HCl Chemical Properties |
| Melting point | 159-161 °C | | InChI | InChI=1S/C13H21NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,12,14-17H,7-8H2,1-3H3 | | InChIKey | NDAUXUAQIAJITI-UHFFFAOYSA-N | | SMILES | CC(C)(NCC(O)C1C=CC(O)=C(CO)C=1)C |
| | Salbutamol EP Impurity B HCl Usage And Synthesis |
| | Salbutamol EP Impurity B HCl Preparation Products And Raw materials |
|