|
|
| | 1-Acetylpyrrolidine Basic information |
| Product Name: | 1-Acetylpyrrolidine | | Synonyms: | 1-Pyrrolidin-1-yl-ethanone;N-Acetypyrrolidine;Pyrrolidine, N-acetyl;1-ACETYLPYRROLIDINE;N-ACETYLPYRROLIDINE;N-Acetylpyrrolidine, Pract.;1-Pyrrolidinoethanone;Methylpyrrolizinoketone | | CAS: | 4030-18-6 | | MF: | C6H11NO | | MW: | 113.16 | | EINECS: | | | Product Categories: | | | Mol File: | 4030-18-6.mol |  |
| | 1-Acetylpyrrolidine Chemical Properties |
| Boiling point | 105-107°C 15mm | | density | 1.02 | | refractive index | 1.4700-1.4800 | | Fp | 91° | | storage temp. | Store at room temperature | | Water Solubility | Soluble in water | | form | clear liquid | | pka | -0.41±0.20(Predicted) | | color | Colorless to Light yellow to Light orange | | Henry's Law Constant | 6.2×103 mol/(m3Pa) at 25℃, Gibbs et al. (1991) | | InChI | InChI=1S/C6H11NO/c1-6(8)7-4-2-3-5-7/h2-5H2,1H3 | | InChIKey | LNWWQYYLZVZXKS-UHFFFAOYSA-N | | SMILES | C(=O)(N1CCCC1)C | | CAS DataBase Reference | 4030-18-6(CAS DataBase Reference) |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | 1993 | | HS Code | 2933998090 |
| | 1-Acetylpyrrolidine Usage And Synthesis |
| Uses | 1-Acetylpyrrolidine is a useful reagent for the synthesis of disubstituted multifunctional indenes. | | Synthesis Reference(s) | Tetrahedron, 52, p. 3403, 1996 DOI: 10.1016/0040-4020(96)00037-3
Tetrahedron Letters, 35, p. 477, 1994 DOI: 10.1016/0040-4039(94)85085-2 | | Research | A rapid method has been developed for determining phenolic hydroxyl groups in lignins. The method comprises acetylation, selective aminolysis of the phenolic acetyl groups by pyrrolidine (aminolysis), and determination of the resulting 1-acetylpyrrolidine by gas chromatography[1].
| | References | [1] Mnsson, P. “Quantitative Determination of Phenolic and Total Hydroxyl Groups in Lignins.” 1900. 0.
|
| | 1-Acetylpyrrolidine Preparation Products And Raw materials |
|