2-tert-Butoxycarbonylamino-acrylic acid methyl ester manufacturers
|
| | 2-tert-Butoxycarbonylamino-acrylic acid methyl ester Basic information |
| | 2-tert-Butoxycarbonylamino-acrylic acid methyl ester Chemical Properties |
| Boiling point | 265.3±32.0 °C(Predicted) | | density | 1.071±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.55±0.46(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H15NO4/c1-6(7(11)13-5)10-8(12)14-9(2,3)4/h1H2,2-5H3,(H,10,12) | | InChIKey | MGBHVVGQPZDMHA-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(NC(OC(C)(C)C)=O)=C |
| | 2-tert-Butoxycarbonylamino-acrylic acid methyl ester Usage And Synthesis |
| | 2-tert-Butoxycarbonylamino-acrylic acid methyl ester Preparation Products And Raw materials |
|