| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | D-Galacturonic acid Basic information |
| Product Name: | D-Galacturonic acid | | Synonyms: | D-Galacturonic acid,monosodium salt (9CI);D-Galacturonic acid sodium salt >=95.0% (T);D-(+)-Galacturonic sodium salt;D-Galacturonic acid sodiuM salt >=98.0% (T);(4S)-3,4,5,6-tetrahydroxyoxane-2-carboxylate;D-(+)-Galacturonic acid (sodium);D-Galacturonic acid sodium salt;Sodium (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate | | CAS: | 14984-39-5 | | MF: | C6H11NaO7 | | MW: | 218.14 | | EINECS: | | | Product Categories: | Carbohydrates;Carbohydrates A to;Carbohydrates GBiochemicals and Reagents;MonosaccharideSpecialty Synthesis;Carbohydrate Synthesis;Monosaccharides;Specialty Synthesis | | Mol File: | 14984-39-5.mol |  |
| | D-Galacturonic acid Chemical Properties |
| form | Powder | | color | White to Off-white | | biological source | plant | | Optical Rotation | [α]/D +36.5±2°, 5 hr, c = 10% in H2O | | Sensitive | Hygroscopic | | InChI | 1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1/t1-,2+,3+,4-,6;/m0./s1 | | InChIKey | MSXHSNHNTORCAW-KSSASCOMSA-M | | SMILES | [Na+].OC1O[C@@H]([C@H](O)[C@H](O)[C@H]1O)C([O-])=O |
| WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids |
| | D-Galacturonic acid Usage And Synthesis |
| Uses | D-(+)-Galacturonic acid sodium salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| | D-Galacturonic acid Preparation Products And Raw materials |
|