| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl 3-amino-5-(4-chlorophenyl)thiophe& Basic information |
| | Ethyl 3-amino-5-(4-chlorophenyl)thiophe& Chemical Properties |
| Melting point | 107-111 °C (lit.) | | Boiling point | 472.8±45.0 °C(Predicted) | | density | 1.323±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | solid | | pka | 1.53±0.10(Predicted) | | Appearance | Brown to black Solid | | InChI | 1S/C13H12ClNO2S/c1-2-17-13(16)12-10(15)7-11(18-12)8-3-5-9(14)6-4-8/h3-7H,2,15H2,1H3 | | InChIKey | VOIKQRXCKXHXNF-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1sc(cc1N)-c2ccc(Cl)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ethyl 3-amino-5-(4-chlorophenyl)thiophe& Usage And Synthesis |
| | Ethyl 3-amino-5-(4-chlorophenyl)thiophe& Preparation Products And Raw materials |
|