| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3,4-Propylenedioxythiophene-2,5-dicarboxylic acid Basic information |
| Product Name: | 3,4-Propylenedioxythiophene-2,5-dicarboxylic acid | | Synonyms: | 3 4-PROPYLENEDIOXYTHIOPHENE-2 5-DICARBO&;3,4-Propylenedioxythiophene-2,5-dicarboxylic acid 97%;3,4-Dihydro-2H-thieno[3,4-b][1,4]dioxepine-6,8-dicarboxylic acid;2H-Thieno[3,4-b][1,4]dioxepin-6,8-dicarboxylic acid, 3,4-dihydro-;3,4-PROPYLENEDIOXYTHIOPHENE-2,5-DICARBOXYLIC ACID;3,4-dihydro-2H-thiophenebenzo[3,4-b][1,4]dioxyclohexane-6,8-dimacetic acid | | CAS: | 177364-98-6 | | MF: | C9H8O6S | | MW: | 244.22 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 177364-98-6.mol |  |
| | 3,4-Propylenedioxythiophene-2,5-dicarboxylic acid Chemical Properties |
| Melting point | >250 °C (dec.) | | Boiling point | 482.6±45.0 °C(Predicted) | | density | 1.621±0.06 g/cm3(Predicted) | | form | solid | | pka | 3.56±0.20(Predicted) | | InChI | 1S/C9H8O6S/c10-8(11)6-4-5(7(16-6)9(12)13)15-3-1-2-14-4/h1-3H2,(H,10,11)(H,12,13) | | InChIKey | MCLQXEPXGNPDHG-UHFFFAOYSA-N | | SMILES | OC(=O)c1sc(C(O)=O)c2OCCCOc12 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,4-Propylenedioxythiophene-2,5-dicarboxylic acid Usage And Synthesis |
| Uses | ProDOT is a conjugating polymer that can be used in the fabrication of a variety of organic electronics which include electrochromic devices, lithium ion batteries, and organic semiconductors. | | General Description | 3,4-Propylenedioxythiophene-2,5-dicarboxylic acid (ProDOT) is an electron rich conducting polymer that can be used in organic and bio-electronics. It can functionalize a variety of polymers by enhancing the intrinsic properties. |
| | 3,4-Propylenedioxythiophene-2,5-dicarboxylic acid Preparation Products And Raw materials |
|