| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:6-(4-BroMophenyl)-4,5-dihydro-3(2H)-pyridazinone, 98% CAS:36725-37-8 Package:1g Remarks:H50588
|
|
| | 6-(4-BROMOPHENYL)-4 5-DIHYDRO-2H-PYRIDA& Basic information |
| | 6-(4-BROMOPHENYL)-4 5-DIHYDRO-2H-PYRIDA& Chemical Properties |
| Melting point | 167-171 °C(lit.) | | InChI | 1S/C10H9BrN2O/c11-8-3-1-7(2-4-8)9-5-6-10(14)13-12-9/h1-4H,5-6H2,(H,13,14) | | InChIKey | CDDNLMGOLYMTSF-UHFFFAOYSA-N | | SMILES | Brc1ccc(cc1)C2=NNC(=O)CC2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 6-(4-BROMOPHENYL)-4 5-DIHYDRO-2H-PYRIDA& Usage And Synthesis |
| | 6-(4-BROMOPHENYL)-4 5-DIHYDRO-2H-PYRIDA& Preparation Products And Raw materials |
|