| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | 3 3 3-TRIFLUORO-(2-PIPERIDINYLMETHYL)PR& Basic information |
| | 3 3 3-TRIFLUORO-(2-PIPERIDINYLMETHYL)PR& Chemical Properties |
| Melting point | 133-137 °C(lit.) | | InChI | 1S/C9H14F3NO2/c10-9(11,12)7(8(14)15)5-6-3-1-2-4-13-6/h6-7,13H,1-5H2,(H,14,15) | | InChIKey | PQIQQLVQNDTREE-UHFFFAOYSA-N | | SMILES | OC(=O)C(CC1CCCCN1)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3 3 3-TRIFLUORO-(2-PIPERIDINYLMETHYL)PR& Usage And Synthesis |
| | 3 3 3-TRIFLUORO-(2-PIPERIDINYLMETHYL)PR& Preparation Products And Raw materials |
|