| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chloro-4-(trifluoromethyl)nicotinic acid Basic information |
| Product Name: | 2-Chloro-4-(trifluoromethyl)nicotinic acid | | Synonyms: | 2-Chloro-4-(trifluoromethyl)pyridine-3-carboxy;2-CHLORO-4-(TRIFLUOROMETHYL)PYRIDINE-3-CARBOXYLIC ACID;2-Chloro-4-(trifluoromethyl)nicotinic acid;2-Chloro-4-(trifluoromethyl)pyridine-3-carboxylic acid, 97+%;2-Chloro-4-(trifluoromethyl)pyridine-3-carboxylic acid, 3-Carboxy-2-chloro-4-(trifluoromethyl)pyridine;3-Pyridinecarboxylic acid, 2-chloro-4-(trifluoromethyl)- | | CAS: | 590371-81-6 | | MF: | C7H3ClF3NO2 | | MW: | 225.55 | | EINECS: | 637-388-1 | | Product Categories: | | | Mol File: | 590371-81-6.mol |  |
| | 2-Chloro-4-(trifluoromethyl)nicotinic acid Chemical Properties |
| Melting point | 158-159°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | color | White | | InChI | InChI=1S/C7H3ClF3NO2/c8-5-4(6(13)14)3(1-2-12-5)7(9,10)11/h1-2H,(H,13,14) | | InChIKey | FZIJHEOXLKCIRZ-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC(C(F)(F)F)=C1C(O)=O |
| Hazard Codes | Xi,Xn | | Risk Statements | 21/22-36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Chloro-4-(trifluoromethyl)nicotinic acid Usage And Synthesis |
| Uses | 2-CHLORO-4-(TRIFLUOROMETHYL)NICOTINIC ACID is widely used in the preparation of new pesticides and the research and development of pharmaceutical intermediates. |
| | 2-Chloro-4-(trifluoromethyl)nicotinic acid Preparation Products And Raw materials |
|