- 5,6-DIAMINO-2-PICOLINE,
-
- $0.00 / 25kg
-
2025-12-01
- CAS:33259-72-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 5,6-DIAMINO-2-PICOLINE, Basic information |
| Product Name: | 5,6-DIAMINO-2-PICOLINE, | | Synonyms: | 2,3-Diamino-6-methylpyridine;2,3-PyridinediaMine, 6-Methyl-;6-Methyl-2,3-pyridinediamine;6-methylpyridine-2,3-diamine 2HCl | | CAS: | 33259-72-2 | | MF: | C6H9N3 | | MW: | 123.16 | | EINECS: | 820-604-5 | | Product Categories: | | | Mol File: | 33259-72-2.mol |  |
| | 5,6-DIAMINO-2-PICOLINE, Chemical Properties |
| Melting point | 69-70℃ | | Boiling point | 295℃ | | density | 1.190 | | refractive index | 1.4690 (estimate) | | Fp | 157℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 6.88±0.50(Predicted) | | Appearance | Brown to dark brown Solid | | InChI | InChI=1S/C6H9N3/c1-4-2-3-5(7)6(8)9-4/h2-3H,7H2,1H3,(H2,8,9) | | InChIKey | XATOCNYGIWXIQM-UHFFFAOYSA-N | | SMILES | C1(N)=NC(C)=CC=C1N |
| | 5,6-DIAMINO-2-PICOLINE, Usage And Synthesis |
| | 5,6-DIAMINO-2-PICOLINE, Preparation Products And Raw materials |
|