|
|
| | N-Isopropylhydroxylamine Basic information |
| Product Name: | N-Isopropylhydroxylamine | | Synonyms: | N-Isopropylhydroxylamine;N-Isopropylhydroxylamine oxalate salt;2-Propanamine, N-hydroxy-;2-hydroxylaminopropane;N-Hydroxyisopropylamine;N-Isopropylhydroxyamine;N-Hydroxy-2-propanamine;Einecs 225-791-1 | | CAS: | 5080-22-8 | | MF: | C3H9NO | | MW: | 75.11 | | EINECS: | 225-791-1 | | Product Categories: | K00001 | | Mol File: | 5080-22-8.mol |  |
| | N-Isopropylhydroxylamine Chemical Properties |
| Melting point | 159-160 °C (dec.) | | Boiling point | 104.9±23.0 °C(Predicted) | | density | 0.886±0.06 g/cm3(Predicted) | | vapor pressure | 68Pa at 25℃ | | pka | 14.14±0.50(Predicted) | | Water Solubility | 199g/L at 25℃ | | InChI | InChI=1S/C3H9NO/c1-3(2)4-5/h3-5H,1-2H3 | | InChIKey | ODHYIQOBTIWVRZ-UHFFFAOYSA-N | | SMILES | CC(NO)C | | LogP | -0.574 at 23℃ | | EPA Substance Registry System | 2-Propanamine, N-hydroxy- (5080-22-8) |
| Hazard Codes | Xn | | Risk Statements | 21/22 | | Safety Statements | 24/25 | | TSCA | TSCA listed |
| | N-Isopropylhydroxylamine Usage And Synthesis |
| Uses | N-Isopropylhydroxylamine is used in preparation method of Methylstyrene Butadiene rubber. |
| | N-Isopropylhydroxylamine Preparation Products And Raw materials |
|