|
|
| | SILICON 2 9 16 23-TETRA-TERT-BUTYL-29H Basic information |
| Product Name: | SILICON 2 9 16 23-TETRA-TERT-BUTYL-29H | | Synonyms: | Silicon 2,9,16,23-tetra-tert-butyl-29H,31H-phthalocyanine dihydroxide Dye content 80 %;SILICON 2 9 16 23-TETRA-TERT-BUTYL-29H;Silicon 2,9,16,23-tetra-tert-butyl-29H,31H-phthalocyanine dihydroxide;(OC-6-12)-Dihydroxy[2,9,16,23-tetrakis(1,1-dimethylethyl)-29H,31H-phthalocyaninato(2-)-κN29,κN30,κN31,κN32]silicon | | CAS: | 85214-70-6 | | MF: | C48H48N8O2Si | | MW: | 797.05 | | EINECS: | | | Product Categories: | Infrared (IR) DyesPhotonic and Optical Materials;Organic Electronics and Photonics;Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Phthalocyanines | | Mol File: | 85214-70-6.mol |  |
| | SILICON 2 9 16 23-TETRA-TERT-BUTYL-29H Chemical Properties |
| Melting point | >300 °C(lit.) | | form | solid | | λmax | 678 nm | | InChIKey | YTJFELPKNFDSGI-ONAHWTHPSA-N | | SMILES | CC(C)(C)c1ccc2c3nc(nc4n5c(nc6nc(nc7n(c(n3)c8cc(ccc78)C(C)(C)C)[Si]5(O)O)c9cc(ccc69)C(C)(C)C)c%10cc(ccc4%10)C(C)(C)C)c2c1 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | SILICON 2 9 16 23-TETRA-TERT-BUTYL-29H Usage And Synthesis |
| | SILICON 2 9 16 23-TETRA-TERT-BUTYL-29H Preparation Products And Raw materials |
|