| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(Methylamino)cyclohexanone 2 2-dimeth& Basic information |
| Product Name: | 4-(Methylamino)cyclohexanone 2 2-dimeth& | | Synonyms: | 4-(Methylamino)cyclohexanone-2,2-dimethyltrimethyleneketalHCl;4-(METHYLAMINO)CYCLOHEXANONE 2,2-DIMETHYL-TRIMETHYLENE KETAL HYDROCHLORIDE 97%;N,3,3-triMethyl-1,5-dioxaspiro[5.5]undecan-9-aMine hydrochloride;3,3-Dimethyl-9-(methylamino)-1,5-dioxaspiro[5.5]undecane hydrochloride;N,3,3-Trimethyl-1,5-dioxaspiro[5.5]undecan-9-amine hydrochloride, N-(3,3-Dimethyl-1,5-dioxaspiro[5.5]undec-9-yl)methylamine hydrochloride, 4-(Methylamino)cyclohexan-1-one 2,2-dimethyltrimethylene keta
l hydrochloride;4-(methylamino)cyclohexanone 2,2-dimethyl-trimeth;1,5-Dioxaspiro[5.5]undecan-9-amine, N,3,3-trimethyl-, hydrochloride (1:1);4-(methylamino)cyclohexanone 2,2-dimethyl-trimethylene | | CAS: | 158747-10-5 | | MF: | C12H24ClNO2 | | MW: | 249.78 | | EINECS: | 273-918-4 | | Product Categories: | Acetals/Ketals/Ortho Esters;Organic Building Blocks;Oxygen Compounds | | Mol File: | 158747-10-5.mol |  |
| | 4-(Methylamino)cyclohexanone 2 2-dimeth& Chemical Properties |
| Melting point | 229-234 °C(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C12H23NO2.ClH/c1-11(2)8-14-12(15-9-11)6-4-10(13-3)5-7-12;/h10,13H,4-9H2,1-3H3;1H | | InChIKey | SUTDEUGEHVLMEF-UHFFFAOYSA-N | | SMILES | Cl[H].CNC1CCC2(CC1)OCC(C)(C)CO2 |
| WGK Germany | 3 | | F | 3-10 | | HS Code | 2932990090 | | Storage Class | 13 - Non Combustible Solids |
| | 4-(Methylamino)cyclohexanone 2 2-dimeth& Usage And Synthesis |
| Uses | 4-(Methylamino)cyclohexanone 2,2-dimethyltrimethylene ketal hydrochloride is also known as N,3,3-trimethyl-1,5-dioxaspiro[5.5]undecan-9-amine hydrochloride (1:1). | | General Description | 4-(Methylamino)cyclohexanone 2,2-dimethyltrimethylene ketal hydrochloride is also known as N,3,3-trimethyl-1,5-dioxaspiro[5.5]undecan-9-amine hydrochloride (1:1). |
| | 4-(Methylamino)cyclohexanone 2 2-dimeth& Preparation Products And Raw materials |
|