|
|
| | 1 4-Dimethylpyridinium p-toluenesulfona& Basic information |
| Product Name: | 1 4-Dimethylpyridinium p-toluenesulfona& | | Synonyms: | 1,4-DIMETHYLPYRIDINIUM P-TOLUENESULFONAT E,98%;1,4-Dimethylpyridinium p-toluenesulfonate 98%;1,4-Dimethylpyridin-1-ium 4-methylbenzenesulfonate;1,4-Dimethylpyridinium p-toluenesulfonate;1 4-Dimethylpyridinium p-toluenesulfona& | | CAS: | 78105-28-9 | | MF: | C14H17NO3S | | MW: | 279.35468 | | EINECS: | | | Product Categories: | | | Mol File: | 78105-28-9.mol |  |
| | 1 4-Dimethylpyridinium p-toluenesulfona& Chemical Properties |
| Melting point | 148-151°C (lit.) | | storage temp. | room temp | | solubility | methanol: 25mg/mL, clear | | form | powder, crystals or chunks | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C7H10N.C7H8O3S/c1-7-3-5-8(2)6-4-7;1-6-2-4-7(5-3-6)11(8,9)10/h3-6H,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 | | InChIKey | DKEMQXFWHOQUEA-UHFFFAOYSA-M | | SMILES | Cc1cc[n+](C)cc1.Cc2ccc(cc2)S([O-])(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1 4-Dimethylpyridinium p-toluenesulfona& Usage And Synthesis |
| Uses | 1,4-Dimethylpyridinium p-toluenesulfonate is a dimethyl PPTS derivative th at has been used as a catalyst in the esterification process for the preparation of side chains of nonlinear optical polymer. |
| | 1 4-Dimethylpyridinium p-toluenesulfona& Preparation Products And Raw materials |
|