|
|
| | 1-NITRO-2-NAPHTHALDEHYDE 97 Basic information |
| | 1-NITRO-2-NAPHTHALDEHYDE 97 Chemical Properties |
| Melting point | 109-110 °C(lit.) | | storage temp. | 2-8°C, stored under nitrogen | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C11H7NO3/c13-7-9-6-5-8-3-1-2-4-10(8)11(9)12(14)15/h1-7H | | InChIKey | XQIMHJNMEFIADP-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1c(C=O)ccc2ccccc12 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1-NITRO-2-NAPHTHALDEHYDE 97 Usage And Synthesis |
| Chemical Properties | Yellow to brown crystalline powder | | Uses | 1-Nitro-2-naphthaldehyde (NAA) may be used to prepare the precursors required for the preparation of 3-acetoxy-2-methylene-3-(1-nitronaphth-2-yl)propanoate and ethyl 3-acetoxy-2-methylene-3-(1-nitronaphth-2-yl)propanoate. | | General Description | On irradiation with UV light, 1-nitro-2-naphthaldehyde gets transformed into the corresponding nitroso acid. |
| | 1-NITRO-2-NAPHTHALDEHYDE 97 Preparation Products And Raw materials |
|