| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-((tert-Butyldimethylsilyl)oxy)benzald& Basic information |
| | 4-((tert-Butyldimethylsilyl)oxy)benzald& Chemical Properties |
| Boiling point | 224-226 °C(lit.) | | density | 0.957 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5110(lit.) | | Fp | >230 °F | | form | liquid | | color | Yellow | | InChI | 1S/C13H20O2Si/c1-13(2,3)16(4,5)15-12-8-6-11(10-14)7-9-12/h6-10H,1-5H3 | | InChIKey | XACWSBWCLJXKGI-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29310099 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4 Eye Dam. 1 |
| | 4-((tert-Butyldimethylsilyl)oxy)benzald& Usage And Synthesis |
| Uses | 4-(tert-Butyldimethylsilyloxy)benzaldehyde is used as a reagent in the synthesis of many organic compounds including that of benzimidazoles which are important structural motifs due to application of their various biological properties. |
| | 4-((tert-Butyldimethylsilyl)oxy)benzald& Preparation Products And Raw materials |
|