|
|
| | Acetyl-d3-L-carnitine HCl Basic information |
| Product Name: | Acetyl-d3-L-carnitine HCl | | Synonyms: | Acetyl-L-carnitine-d3 (chloride);L-Acetylcarnitine D3 Hydrochloride;Acetyl-d3-L-carnitine hydrochloride;Acetyl-D3-Acetyl-L-carnitine HCl;Acetyl-D3-L-Carnitine Hcl (Standard);Acetyl-L-carnitine-d3-1 hydrochloride | | CAS: | 362049-62-5 | | MF: | C9H15D3ClNO4 | | MW: | 242.72 | | EINECS: | | | Product Categories: | | | Mol File: | 362049-62-5.mol |  |
| | Acetyl-d3-L-carnitine HCl Chemical Properties |
| Melting point | 194°C (dec.) (lit.) | | storage temp. | Store at -20°C | | solubility | Methanol: slightly soluble, | | form | A solid | | color | White to off-white | | Optical Rotation | [α]25/D -28°, c =1 in H2O | | Water Solubility | Water: soluble | | InChI | 1S/C9H17NO4.ClH/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;/h8H,5-6H2,1-4H3;1H/t8-;/m1./s1/i1D3; | | InChIKey | JATPLOXBFFRHDN-SPMMGKNWSA-N | | SMILES | [Cl-].[2H]C([2H])([2H])C(=O)O[C@H](CC(O)=O)C[N+](C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Acetyl-d3-L-carnitine HCl Usage And Synthesis |
| Uses | Acetyl-d3 L-Carnitine Hydrochloride is labelled Acetyl L-Carnitine Hydrochloride (A171990) which is used for transmembrane action potential studies. Acetylcarnitine has antinociceptive activity that may be mediated by enhanced activity of muscarinic cholinergic receptors or mGlu2 glutamate receptors. |
| | Acetyl-d3-L-carnitine HCl Preparation Products And Raw materials |
|