|
|
| | 5-Nitro-2-piperidinobenzaldehyde Basic information |
| | 5-Nitro-2-piperidinobenzaldehyde Chemical Properties |
| Melting point | 122-123 | | Boiling point | 413.5±40.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | pka | 0.61±0.40(Predicted) | | form | solid | | InChI | 1S/C12H14N2O3/c15-9-10-8-11(14(16)17)4-5-12(10)13-6-2-1-3-7-13/h4-5,8-9H,1-3,6-7H2 | | InChIKey | WPONLEWKUHGAEI-UHFFFAOYSA-N | | SMILES | O=C(C1=CC([N+]([O-])=O)=CC=C1N2CCCCC2)[H] |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 5-Nitro-2-piperidinobenzaldehyde Usage And Synthesis |
| | 5-Nitro-2-piperidinobenzaldehyde Preparation Products And Raw materials |
|