Furo[3,4-b]pyridin-5(7H)-one, 4-[3-(4-fluorophenyl)-1-methyl-1H-pyrazol-4-yl]- manufacturers
- CK1-IN-2
-
- $68.00
-
2026-07-27
- CAS:1383376-92-8
- Purity: 99.31%
- Supply Ability: 10g
|
| | Furo[3,4-b]pyridin-5(7H)-one, 4-[3-(4-fluorophenyl)-1-methyl-1H-pyrazol-4-yl]- Basic information |
| | Furo[3,4-b]pyridin-5(7H)-one, 4-[3-(4-fluorophenyl)-1-methyl-1H-pyrazol-4-yl]- Chemical Properties |
| Boiling point | 509.7±50.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | pka | 0.89±0.20(Predicted) | | form | Solid | | color | Off-white to light yellow | | InChI | InChI=1S/C17H12FN3O2/c1-21-8-13(16(20-21)10-2-4-11(18)5-3-10)12-6-7-19-14-9-23-17(22)15(12)14/h2-8H,9H2,1H3 | | InChIKey | XISSYJGQGSMWHO-UHFFFAOYSA-N | | SMILES | C12COC(=O)C1=C(C1=CN(C)N=C1C1=CC=C(F)C=C1)C=CN=2 |
| | Furo[3,4-b]pyridin-5(7H)-one, 4-[3-(4-fluorophenyl)-1-methyl-1H-pyrazol-4-yl]- Usage And Synthesis |
| Uses | CK1-IN-2 (compound Nr.4) is a potent CK1 inhibitor with an IC50 values of 123, 19.8, 26.8, 74.3 nM for CK1a, CK1d, CK1e, p38a, respectively[1]. | | IC 50 | CKIα: 123 nM (IC50) | | References | [1] Joris De Maeyer, et al. Casein kinase 1 inhibitors for use in the treatment of diseases related to dux4 expression such as muscular dystrophy and cancer. WO2020249717A1. |
| | Furo[3,4-b]pyridin-5(7H)-one, 4-[3-(4-fluorophenyl)-1-methyl-1H-pyrazol-4-yl]- Preparation Products And Raw materials |
|