|
|
| | 2-Isopropyl-1-methyl-d3-5-nitro-1H-imidazole Basic information |
| | 2-Isopropyl-1-methyl-d3-5-nitro-1H-imidazole Chemical Properties |
| Melting point | 56-58°C | | storage temp. | Refrigerator | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly) | | color | Off-White to Yellow | | Major Application | clinical testing | | InChI | 1S/C7H11N3O2/c1-5(2)7-8-4-6(9(7)3)10(11)12/h4-5H,1-3H3/i3D3 | | InChIKey | NTAFJUSDNOSFFY-HPRDVNIFSA-N | | SMILES | [2H]C([2H])([2H])n1c(ncc1[N+]([O-])=O)C(C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Isopropyl-1-methyl-d3-5-nitro-1H-imidazole Usage And Synthesis |
| Uses | Labelled Ipronidazole (I747000). An antihistomonal agent. Antiprotozoal (Histomonas). |
| | 2-Isopropyl-1-methyl-d3-5-nitro-1H-imidazole Preparation Products And Raw materials |
|