|
|
| | 5-Trans prostaglandin E2 Basic information |
| Product Name: | 5-Trans prostaglandin E2 | | Synonyms: | TRANS-DINOPROSTONE;9-OXO-11ALPHA,15S-DIHYDROXY-PROSTA-5E,13E-DIEN-1-OIC ACID;Prosta-5,13-dien-1-oic acid, 11,15-dihydroxy-9-oxo-, (5E,11α,13E,15S)-;Alprostadil EP Impurity H;Prostaglandin Impurity 7;Dinoprostone EP Impurity C;Dinoprostone EP Impurity CQ: What is
Dinoprostone EP Impurity C Q: What is the CAS Number of
Dinoprostone EP Impurity C Q: What is the storage condition of
Dinoprostone EP Impurity C Q: What are the applications of
Dinoprostone EP Impurity C;Dinoprostone Related Compound C ((E)-7-{(1R,2R,3R)-3-Hydroxy-2-[(S,E)-3-hydroxyoct-1-en-1-yl]-5-oxo (1213136) | | CAS: | 36150-00-2 | | MF: | C20H32O5 | | MW: | 352.47 | | EINECS: | | | Product Categories: | | | Mol File: | 36150-00-2.mol |  |
| | 5-Trans prostaglandin E2 Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMF: >100 mg/ml; DMSO: >100 mg/ml; Ethanol: >100 mg/ml; PBS pH 7.2: >5 mg/ml | | form | A crystalline solid | | Major Application | pharmaceutical (small molecule) | | InChIKey | XEYBRNLFEZDVAW-BRNHSORCSA-N | | SMILES | O[C@H]1[C@@H]([C@H](C(=O)C1)C\C=C\CCCC(=O)O)\C=C\[C@@H](O)CCCCC |
| WGK Germany | WGK 3 | | HS Code | 2937500000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Repr. 1B |
| | 5-Trans prostaglandin E2 Usage And Synthesis |
| Uses | 5-trans-Prostaglandin E2 is used as a substance for the isolation of new naturally occuring prostaglandin 5-trans-PGA2, in the synthesis of 5-trans-PGE2, 5-trans-PGF2a and their 5,6-trans isomers. |
| | 5-Trans prostaglandin E2 Preparation Products And Raw materials |
|