| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
- Morniflumate
-
- $1.10
-
2026-08-20
- CAS:65847-85-0
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- Morniflumate
-
- $39.00
-
2026-07-15
- CAS:65847-85-0
- Purity: 99.12%
- Supply Ability: 10g
- Morniflumate
-
- $1.00
-
2019-12-23
- CAS:65847-85-0
- Min. Order: 1g
- Purity: 85.0-99.8%
- Supply Ability: 20ton
|
| | Morniflumate Basic information |
| Product Name: | Morniflumate | | Synonyms: | 3-pyridinecarboxylic acid 2-[[3-(trifluoromethyl)phenyl]-amino]-2-(4-morpholinyl)-ethyl ester;2-[[3-(trifluoromethyl)phenyl]-amino]-2-(4-morpholinyl)-ethyl nicotinate;MORNIFLUMATE;2-[[3-(Trifluoromethyl)phenyl]amino]-3-pyridinecarboxylic acid 2-(4-morpholinyl)ethyl ester;UP-164;2-Morpholinoethyl 2-((3-(trifluoroMethyl)phenyl)aMino)nicotinate;2-morpholin-4-ylethyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate;b-Morpholinoethyl ester | | CAS: | 65847-85-0 | | MF: | C19H20F3N3O3 | | MW: | 395.38 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 65847-85-0.mol |  |
| | Morniflumate Chemical Properties |
| Melting point | 75-77°C | | Boiling point | 478.2±45.0 °C(Predicted) | | density | 1.312±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Gel | | pka | 5.80±0.10(Predicted) | | color | Pale to Light Yellow | | InChI | InChI=1S/C19H20F3N3O3/c20-19(21,22)14-3-1-4-15(13-14)24-17-16(5-2-6-23-17)18(26)28-12-9-25-7-10-27-11-8-25/h1-6,13H,7-12H2,(H,23,24) | | InChIKey | LDXSPUSKBDTEKA-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=CC(C(F)(F)F)=C2)=NC=CC=C1C(OCCN1CCOCC1)=O | | CAS DataBase Reference | 65847-85-0(CAS DataBase Reference) |
| | Morniflumate Usage And Synthesis |
| Uses | Anti-inflammatory. | | Uses | Morniflumate is a non-steroidal anti-inflammatory drug. | | Definition | ChEBI: Morniflumate is a member of (trifluoromethyl)benzenes. |
| | Morniflumate Preparation Products And Raw materials |
|