|
|
| | 2-Chloro-6,7-dimethoxy-quinoline-3-carbaldehyde Basic information |
| | 2-Chloro-6,7-dimethoxy-quinoline-3-carbaldehyde Chemical Properties |
| Melting point | 265-267 °C | | Boiling point | 393.9±37.0 °C(Predicted) | | density | 1.335±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | -0.95±0.50(Predicted) | | Appearance | Light yellow to light brown Solid | | InChI | 1S/C12H10ClNO3/c1-16-10-4-7-3-8(6-15)12(13)14-9(7)5-11(10)17-2/h3-6H,1-2H3 | | InChIKey | CCJKLPYJNAHFIE-UHFFFAOYSA-N | | SMILES | O=C([H])C1=CC2=CC(OC)=C(OC)C=C2N=C1Cl |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Chloro-6,7-dimethoxy-quinoline-3-carbaldehyde Usage And Synthesis |
| | 2-Chloro-6,7-dimethoxy-quinoline-3-carbaldehyde Preparation Products And Raw materials |
|