| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:Diazinon-d10 CAS:100155-47-3 Purity:对照品 Package:10mg~500mg Remarks:CC000125D01
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:Diazinon-(diethyl-d10) CAS:100155-47-3 Purity:10Mg 25Mg 100Mg Package:98%
|
- Diazinon-D10
-
-
2026-05-11
- CAS:100155-47-3
- Purity:
- Supply Ability: 10g
|
| | DIAZINON (DIETHYL-D10) Basic information |
| | DIAZINON (DIETHYL-D10) Chemical Properties |
| Boiling point | 83-84 °C0.002 mm Hg(lit.) | | density | 1.152 g/mL at 25 °C | | refractive index | n20/D 1.4978(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Methanol (Slightly) | | form | Oil | | pka | 1.790±0.10(predicted) | | color | Colourless to Pale Yellow | | Stability: | Hygroscopic | | Major Application | agriculture environmental | | InChI | 1S/C12H21N2O3PS/c1-6-15-18(19,16-7-2)17-11-8-10(5)13-12(14-11)9(3)4/h8-9H,6-7H2,1-5H3/i1D3,2D3,6D2,7D2 | | InChIKey | FHIVAFMUCKRCQO-HXOHQZFQSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=S)(Oc1cc(C)nc(n1)C(C)C)OC([2H])([2H])C([2H])([2H])[2H] | | EPA Substance Registry System | Phosphorothioic acid, O,O-di(ethyl-d5) O-[6-methyl-2-(1-methylethyl)-4-pyrimidinyl] ester (100155-47-3) |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 24/25-60-61 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | DIAZINON (DIETHYL-D10) Usage And Synthesis |
| Chemical Properties | Liquid | | Uses | A labelled cholinesterase inhibitor; a nonsystemic organophosphate insecticide | | Uses | Diazinon-(diethyl-d10) has been used
- In analytical methods for routine monitoring of residual pesticide.
- As an internal standard in GC–MS quantification of pesticides in food.
|
| | DIAZINON (DIETHYL-D10) Preparation Products And Raw materials |
|