| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,3-DIIMINOBENZ[F]ISOINDOLINE Basic information |
| | 1,3-DIIMINOBENZ[F]ISOINDOLINE Chemical Properties |
| Melting point | 240°C (dec.) (lit.) | | Boiling point | 410.202±28.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.410±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | room temp | | solubility | DMSO: 10mg/mL, clear, yellow | | pka | 7.896±0.20(predicted) | | form | powder to crystal | | color | Orange to Green to Amber | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C12H9N3/c13-11-9-5-7-3-1-2-4-8(7)6-10(9)12(14)15-11/h1-6H,(H3,13,14,15) | | InChIKey | JAWNWEKHDFBPSG-UHFFFAOYSA-N | | SMILES | N=C1NC(=N)c2cc3ccccc3cc12 | | EPA Substance Registry System | 1H-Benz[f]isoindol-3-amine, 1-imino- (65558-69-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933.99.8210 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-DIIMINOBENZ[F]ISOINDOLINE Usage And Synthesis |
| Uses | diagnostic assay manufacturing hematology histology |
| | 1,3-DIIMINOBENZ[F]ISOINDOLINE Preparation Products And Raw materials |
|