|
|
| | (+/-)-Methamphetamine-d8 Basic information |
| Product Name: | (+/-)-Methamphetamine-d8 | | Synonyms: | (±)-Methamphetamine-D8 solution;1,1,1,2,3-pentadeuterio-3-phenyl-N-(trideuteriomethyl)propan-2-amine;(±)-Methamphetamine-D8 solution;(±)-Methamphetamine-D8 solution;(±)-Methamphetamine-D8, 100 ug/mL;(+/-)-Methamphetamine-d8 | | CAS: | 136765-40-7 | | MF: | C10H7D8N | | MW: | 157.28 | | EINECS: | 802-956-1 | | Product Categories: | | | Mol File: | 136765-40-7.mol |  |
| | (+/-)-Methamphetamine-d8 Chemical Properties |
| Boiling point | 215.533±9.00 °C(Press: 760.00 Torr)(predicted) | | density | 0.907±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 9℃ | | storage temp. | 2-8°C | | form | liquid | | pka | 10.382±0.10(predicted) | | Major Application | forensics and toxicology | | InChI | 1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/i1D3,2D3,8D,9D | | InChIKey | MYWUZJCMWCOHBA-URFKORASSA-N | | SMILES | [2H]C([2H])([2H])NC(C([2H])([2H])[2H])([2H])C([H])([2H])C1=C([H])C([H])=C([H])C([H])=C1[H] |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | (+/-)-Methamphetamine-d8 Usage And Synthesis |
| Uses | forensics and toxicology | | General Description | Methamphetamine is a psychostimulant drug of the phenethylamine and amphetamine classes known by the street names "meth," "ice," and "glass". This internal standard is suitable for quantitation of methamphetamine levels in urine, serum, or plasma by LC/MS or GC/MS for urine drug testing, clinical toxicology, sports testing, forensic analysis, or isotope dilution methods. The dextrorotatory isomer of methamphetamine is a pharmaceutical drug sold under the trade name Desoxyn for treatment of ADHD and obesity. |
| | (+/-)-Methamphetamine-d8 Preparation Products And Raw materials |
|