|
|
| | 2-(2-Chloro-3,4-dimethoxyphenyl) ethylamine Basic information |
| Product Name: | 2-(2-Chloro-3,4-dimethoxyphenyl) ethylamine | | Synonyms: | RARECHEM AN KA 0442;2-chloro-3,4-dimethoxyphenethylamine;2-Chloro-3,4-dimethoxylphenethylamine HCl;2-Chloro-3,4-dimethoxybenzeneethanamine;2-(2-chloro-3,4-diMethoxyphenyl)ethan-1-aMine;2-(2-chloro-3,4-dimethoxyphenyl)ethanamine;Benzeneethanamine, 2-chloro-3,4-dimethoxy-;2-Chlor-3,4-dimethoxy-phenaethylamin,2-Chloro-3,4-dimethoxyphenethylamine,EINECS 266-632-6,2-chloro-3,4-dimethoxybenzeneethanamine,2-(2- | | CAS: | 67287-36-9 | | MF: | C10H14ClNO2 | | MW: | 215.68 | | EINECS: | 266-632-6 | | Product Categories: | | | Mol File: | 67287-36-9.mol |  |
| | 2-(2-Chloro-3,4-dimethoxyphenyl) ethylamine Chemical Properties |
| Boiling point | 307.7±37.0 °C(Predicted) | | density | 1.160±0.06 g/cm3(Predicted) | | pka | 9.36±0.10(Predicted) | | InChI | InChI=1S/C10H14ClNO2/c1-13-8-4-3-7(5-6-12)9(11)10(8)14-2/h3-4H,5-6,12H2,1-2H3 | | InChIKey | YTKGUKHQYUHYTQ-UHFFFAOYSA-N | | SMILES | C1(CCN)=CC=C(OC)C(OC)=C1Cl |
| | 2-(2-Chloro-3,4-dimethoxyphenyl) ethylamine Usage And Synthesis |
| Uses | 2-(2-Chloro-3,4-dimethoxyphenyl)ethanamine is a reactant used in the preparation of 1-aryl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diols as potent D-1 dopamine agonists. |
| | 2-(2-Chloro-3,4-dimethoxyphenyl) ethylamine Preparation Products And Raw materials |
|