| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Benzidine-d8 Basic information |
| Product Name: | Benzidine-d8 | | Synonyms: | 4,4'-DIAMINO(BIPHENYL-D8);BENZIDINE-RINGS-D8;BENZIDINE (RING-D8);BENZIDINE-D8 (RINGS-D8);[2H8]-Benzidine;D8-Benzidine;4,4'-Diaminobiphenyl-d8 (Rings-d8);4-(4-amino-2,3,5,6-tetradeuterio-phenyl)-2,3,5,6-tetradeuterio-aniline | | CAS: | 92890-63-6 | | MF: | C12H4D8N2 | | MW: | 192.29 | | EINECS: | | | Product Categories: | | | Mol File: | 92890-63-6.mol |  |
| | Benzidine-d8 Chemical Properties |
| Melting point | 127-128 °C(lit.) | | solubility | Acetone (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Brown | | Major Application | electronics | | InChI | InChI=1S/C12H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,13-14H2/i1D,2D,3D,4D,5D,6D,7D,8D | | InChIKey | HFACYLZERDEVSX-PGRXLJNUSA-N | | SMILES | C1(=C([2H])C(=C(N)C([2H])=C1[2H])[2H])C1C([2H])=C(C(N)=C([2H])C=1[2H])[2H] | | EPA Substance Registry System | Benzidine-d8 (92890-63-6) |
| Hazard Codes | T,N | | Risk Statements | 45-22-50/53 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 1885 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 1A |
| | Benzidine-d8 Usage And Synthesis |
| Uses | Benzidine-d8 is involved in the enhancements in ion abundances in high-performance liquid chromatography, thus improving chromatography efficiency and particle-beam process. | | General Description | Benzidine-(rings-d8) is an isotope of benzidine. |
| | Benzidine-d8 Preparation Products And Raw materials |
|