|
|
| | 3,5-Bis(trifluoromethyl)hydrocinnamic acid Basic information |
| Product Name: | 3,5-Bis(trifluoromethyl)hydrocinnamic acid | | Synonyms: | 3-(3,5-Ditrifluoromethylphenyl)propionic acid;3,5-Bis(trifluoromethyl)benzenepropanoic acid;3-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]PROPIONIC ACID;3-[3,5-Bis(trifluoromethyl)phenyl]propanoic acid;3,5-Bis(trifluoromethyl)hydrocinnamic acid 97%;Benzenepropanoic acid, 3,5-bis(trifluoromethyl)-;3,5-Bis(trifluoromethyl)phenylpropanoic acid;3,5-Bis(trifluoromethyl)hydrocinnamic acid | | CAS: | 181772-16-7 | | MF: | C11H8F6O2 | | MW: | 286.17 | | EINECS: | | | Product Categories: | Building Blocks;C11 to C12;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks | | Mol File: | 181772-16-7.mol |  |
| | 3,5-Bis(trifluoromethyl)hydrocinnamic acid Chemical Properties |
| Melting point | 68-73 °C(lit.) | | Boiling point | 247℃ | | density | 1.427 | | Fp | 103℃ | | pka | 4.45±0.10(Predicted) | | form | solid | | InChI | 1S/C11H8F6O2/c12-10(13,14)7-3-6(1-2-9(18)19)4-8(5-7)11(15,16)17/h3-5H,1-2H2,(H,18,19) | | InChIKey | LISLXJGPJUAEHU-UHFFFAOYSA-N | | SMILES | OC(=O)CCc1cc(cc(c1)C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,5-Bis(trifluoromethyl)hydrocinnamic acid Usage And Synthesis |
| Uses | 3,5-Bis(trifluoroMethyl)hydrocinnaMic acid can be used to prepare novel biologically active amides. |
| | 3,5-Bis(trifluoromethyl)hydrocinnamic acid Preparation Products And Raw materials |
|