5-Ethyl-1,3,4-oxadiazol-2-ylamine manufacturers
|
| | 5-Ethyl-1,3,4-oxadiazol-2-ylamine Basic information |
| Product Name: | 5-Ethyl-1,3,4-oxadiazol-2-ylamine | | Synonyms: | 1,3,4-Oxadiazol-2-amine,5-ethyl-;5-ethyl-1,3,4-oxadiazol-2-amine;2-Amino-5-ethyl-1,3,4-oxadiazol;5-ethyl-1,3,4-oxadiazole-2-amine;2-AMINO-5-ETHYL-1,3,4-OXADIAZOLE;5-Ethyl-1,3,4-oxadiazol-2-ylamine | | CAS: | 3775-61-9 | | MF: | C4H7N3O | | MW: | 113.12 | | EINECS: | | | Product Categories: | | | Mol File: | 3775-61-9.mol |  |
| | 5-Ethyl-1,3,4-oxadiazol-2-ylamine Chemical Properties |
| Melting point | 180-181 °C | | Boiling point | 235.3±23.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | -0.40±0.13(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H7N3O/c1-2-3-6-7-4(5)8-3/h2H2,1H3,(H2,5,7) | | InChIKey | XHSTYRIUVMKGDX-UHFFFAOYSA-N | | SMILES | O1C(CC)=NN=C1N |
| Hazard Codes | Xn | | Risk Statements | 22 |
| | 5-Ethyl-1,3,4-oxadiazol-2-ylamine Usage And Synthesis |
| Uses | 5-Ethyl-1,3,4-oxadiazol-2-amine is used as a reactant in the preparation of (acylimino)thiadiazoline derivatives as angiotensin II receptor antagonists. |
| | 5-Ethyl-1,3,4-oxadiazol-2-ylamine Preparation Products And Raw materials |
|