|
|
| | H-D-LEU-OME HCL Basic information |
| | H-D-LEU-OME HCL Chemical Properties |
| Melting point | 159-163 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | color | White to off-white | | BRN | 6095746 | | Major Application | peptide synthesis | | InChI | 1S/C7H15NO2.ClH/c1-5(2)4-6(8-3)7(9)10;/h5-6,8H,4H2,1-3H3,(H,9,10);1H/t6-;/m0./s1 | | InChIKey | QYFWCUVWMMTENJ-RGMNGODLSA-N | | SMILES | Cl.CN[C@@H](CC(C)C)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2915601990 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | H-D-LEU-OME HCL Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-D-LEU-OME HCL Preparation Products And Raw materials |
|