|
|
| | 7-METHYL-1,6-OCTADIENE Basic information |
| Product Name: | 7-METHYL-1,6-OCTADIENE | | Synonyms: | Methyloctadiene;7-METHYL-1,6-OCTADIENE 96+%;7-methyl-6-octadiene;7-METHYL-1,6-OCTADIENE;7-methylocta-1,6-diene;7-Methyl-1,6-octadien;1,6-Octadiene, 7-methyl- | | CAS: | 42152-47-6 | | MF: | C9H16 | | MW: | 124.22 | | EINECS: | 404-210-7 | | Product Categories: | | | Mol File: | 42152-47-6.mol |  |
| | 7-METHYL-1,6-OCTADIENE Chemical Properties |
| Melting point | -70.83°C (estimate) | | Boiling point | 143-144 °C(lit.) | | density | 0.753 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.436(lit.) | | Fp | 79 °F | | InChI | InChI=1S/C9H16/c1-4-5-6-7-8-9(2)3/h4,8H,1,5-7H2,2-3H3 | | InChIKey | UCKITPBQPGXDHV-UHFFFAOYSA-N | | SMILES | C=CCCC/C=C(\C)/C | | EPA Substance Registry System | 1,6-Octadiene, 7-methyl- (42152-47-6) |
| Hazard Codes | N | | Risk Statements | 10-50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3295 3/PG 3 | | WGK Germany | 2 | | HazardClass | 3.2 | | PackingGroup | III |
| | 7-METHYL-1,6-OCTADIENE Usage And Synthesis |
| | 7-METHYL-1,6-OCTADIENE Preparation Products And Raw materials |
|