| Company Name: |
xinguokeji Gold |
| Tel: |
13120711461 |
| Email: |
363372932@qq.com |
|
| | (R)-(-)-AMINO-3-HYDROXYBUTANOIC ACID Basic information |
| Product Name: | (R)-(-)-AMINO-3-HYDROXYBUTANOIC ACID | | Synonyms: | (R)-(-)-3-Hydroxy-GABA;(R)-(-)-β-Hydroxy-GABA;(R)-GABOB;Butanoic acid, 4-amino-3-hydroxy-, (3R)-;L-γ-Amino-β-hydroxybutyric acid;R-(-)-γ-Amino-β-hydroxybutyric acid;(R)-(+)-4-AMINO-3-HYDROXYBUTANOIC ACID;(R)-4-AMINO-3-HYDROXYBUTYRIC ACID | | CAS: | 7013-07-2 | | MF: | C4H9NO3 | | MW: | 119.12 | | EINECS: | | | Product Categories: | chiral | | Mol File: | 7013-07-2.mol |  |
| | (R)-(-)-AMINO-3-HYDROXYBUTANOIC ACID Chemical Properties |
| Melting point | 216-217 °C (decomp)(Solv: water (7732-18-5); ethanol (64-17-5)) | | Boiling point | 374.5±32.0 °C(Predicted) | | density | 1.312±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | PBS (pH 7.2): 10 mg/ml | | form | Solid | | pka | 4.04±0.10(Predicted) | | color | White | | InChI | InChI=1S/C4H9NO3/c5-2-3(6)1-4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m1/s1 | | InChIKey | YQGDEPYYFWUPGO-GSVOUGTGSA-N | | SMILES | C(O)(=O)C[C@@H](O)CN | | CAS DataBase Reference | 7013-07-2(CAS DataBase Reference) |
| | (R)-(-)-AMINO-3-HYDROXYBUTANOIC ACID Usage And Synthesis |
| Uses | (R)-4-Amino-3-hydroxybutanoic Acid is an intermediate in the synthesis of Stearoyl-L-carnitine-13C3 Chloride (S686517) which is carbon-13 labeled R-Stearoyl Carnitine Chloride (S686515), which is a carnitine ester tested for its ability to inhibit protein kinase C (PKC). |
| | (R)-(-)-AMINO-3-HYDROXYBUTANOIC ACID Preparation Products And Raw materials |
|