|
|
| | 3,4-DIMETHOXYBENZHYDRAZIDE Basic information |
| | 3,4-DIMETHOXYBENZHYDRAZIDE Chemical Properties |
| Melting point | 145-146°C | | density | 1.189±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 12.21±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 2651843 | | InChI | InChI=1S/C9H12N2O3/c1-13-7-4-3-6(9(12)11-10)5-8(7)14-2/h3-5H,10H2,1-2H3,(H,11,12) | | InChIKey | LJMQIGMMUZLDOC-UHFFFAOYSA-N | | SMILES | C(NN)(=O)C1=CC=C(OC)C(OC)=C1 | | CAS DataBase Reference | 41764-74-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2928009090 |
| Provider | Language |
|
ALFA
| English |
| | 3,4-DIMETHOXYBENZHYDRAZIDE Usage And Synthesis |
| | 3,4-DIMETHOXYBENZHYDRAZIDE Preparation Products And Raw materials |
|