|
|
| | Benzo(b)fluoranthene d12 Basic information |
| Product Name: | Benzo(b)fluoranthene d12 | | Synonyms: | BENZ(E)ACEPHENANTHRYLENE-D12;BENZ(E)ACEPHENANTHRYLENE-D12, 98 ATOM % D;[2H12]-Benzo(b)fluoranthene;Benz[e]acephenanthrylene-1,2,3,4,5,6,7,8,9,10,11,12-d12;Benzo[b]fluoranthene-d??;Benzo[b]fluoranthene-d12 in toluene;Benzo(b)fluoranthene(d12)Solution in Isooctane;Benzo[b]fluoranthene-d12 | | CAS: | 93951-98-5 | | MF: | C20H12 | | MW: | 252.32 | | EINECS: | | | Product Categories: | | | Mol File: | 93951-98-5.mol |  |
| | Benzo(b)fluoranthene d12 Chemical Properties |
| Melting point | 163-165 °C(lit.) | | form | solid | | InChI | 1S/C20H12/c1-2-7-14-13(6-1)12-19-16-9-4-3-8-15(16)18-11-5-10-17(14)20(18)19/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D | | InChIKey | FTOVXSOBNPWTSH-AQZSQYOVSA-N | | SMILES | [2H]c1c([2H])c([2H])c-2c(c1[2H])-c3c([2H])c([2H])c([2H])c4c5c([2H])c([2H])c([2H])c([2H])c5c([2H])c-2c34 | | EPA Substance Registry System | Benz[e]acephenanthrylene-1,2,3,4,5,6,7,8,9,10,11,12-d12 (93951-98-5) |
| Hazard Codes | T,N | | Risk Statements | 45-46-20/21/22-50/53 | | Safety Statements | 53-36/37/39-45-61-60 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 1B |
| | Benzo(b)fluoranthene d12 Usage And Synthesis |
| Uses | Benzo[b]fluoranthene-d12 (CAS# 93951-98-5) is a useful isotopically labeled research compound. |
| | Benzo(b)fluoranthene d12 Preparation Products And Raw materials |
|