4,5,6,7-Tetrafluoroindole manufacturers
- 4,5,6,7-TETRAFLUOROINDOLE
-
-
2024-10-22
- CAS:16264-67-8
- Min. Order: 1g
- Purity: 99%min cherry@coreychem.com
- Supply Ability: 1kg/10kg
|
| | 4,5,6,7-Tetrafluoroindole Basic information |
| Product Name: | 4,5,6,7-Tetrafluoroindole | | Synonyms: | 1H-Indole, 4,5,6,7-tetrafluoro-;4,5,6,7-Tetrafluoro-1H-indole98%;4,5,6,7-TETRAFLUOROINDOLE;4,5,6,7-Tetrafluoro-1H-indole 95+%;4,5,6,7-TETRAFLUORO-1H-INDOLE | | CAS: | 16264-67-8 | | MF: | C8H3F4N | | MW: | 189.11 | | EINECS: | | | Product Categories: | | | Mol File: | 16264-67-8.mol |  |
| | 4,5,6,7-Tetrafluoroindole Chemical Properties |
| Melting point | 90-91 | | Boiling point | 258.6±35.0 °C(Predicted) | | density | 1.593±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 13.51±0.30(Predicted) | | color | White | | InChI | InChI=1S/C8H3F4N/c9-4-3-1-2-13-8(3)7(12)6(11)5(4)10/h1-2,13H | | InChIKey | DTNBMVQXEVNTLO-UHFFFAOYSA-N | | SMILES | N1C2=C(C(F)=C(F)C(F)=C2F)C=C1 | | CAS DataBase Reference | 16264-67-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 4,5,6,7-Tetrafluoroindole Usage And Synthesis |
| Uses | 4,5,6,7-Tetrafluoroindole (cas# 16264-67-8) is used as an activator for metallocene-catalyzed polymerization. |
| | 4,5,6,7-Tetrafluoroindole Preparation Products And Raw materials |
|