gamma-Glu-epsilon-Lys manufacturers
- Dipeptide-9
-
- $25.00
-
2024-10-18
- CAS:17105-15-6
- Min. Order: 1Box
- Purity: 99.99%
- Supply Ability: 10000000000
- Dipeptide-9
-
-
2023-03-31
- CAS:17105-15-6
- Min. Order: 1G
- Purity: 99%
- Supply Ability: 100KG
|
| | gamma-Glu-epsilon-Lys Basic information |
| Product Name: | gamma-Glu-epsilon-Lys | | Synonyms: | H-GAMMA-GLU-EPSILON-LYS-OH;H-LYS(RETRO-HO-GLU-H)-OH;H-GLU(H-LYS-OH)-OH;GAMMA-L-GLU-EPSILON-L-LYS;GAMMA-L-GLUTAMYL-EPSILON-L-LYSINE;H-g-Glu-e-Lys-OH, H-Lys(retro-HO-Glu-H)-OH;(2S)-6-amino-2-[[(4S)-4-amino-4-carboxy-butanoyl]amino]hexanoic acid;H-gamma-Glu-epsilon-Lys- | | CAS: | 17105-15-6 | | MF: | C11H21N3O5 | | MW: | 275.3 | | EINECS: | 000-000-0 | | Product Categories: | Dipeptides;Dipeptides and Tripeptides;Peptides | | Mol File: | 17105-15-6.mol |  |
| | gamma-Glu-epsilon-Lys Chemical Properties |
| Boiling point | 613.4±55.0 °C(Predicted) | | density | 1.290±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 2.22±0.10(Predicted) | | form | powder | | color | white | | Cosmetics Ingredients Functions | HUMECTANT
SKIN CONDITIONING
HAIR CONDITIONING | | InChI | 1S/C11H21N3O5/c12-7(10(16)17)3-1-2-6-14-9(15)5-4-8(13)11(18)19/h7-8H,1-6,12-13H2,(H,14,15)(H,16,17)(H,18,19) | | InChIKey | JPKNLFVGUZRHOB-UHFFFAOYSA-N | | SMILES | NC(CCCCNC(=O)CCC(N)C(O)=O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | gamma-Glu-epsilon-Lys Usage And Synthesis |
| Uses | GammaGlu-epsilonLys (γ-Glu-ε-Lys) is used to study the functions and processing of endo-epsilon(-gamma-Glu)-Lys isopeptide bonds in biological processes. | | Definition | ChEBI: An N6-acyl-L-lysine derivative in which the acyl group is specified as gamma-glutamyl. | | IC 50 | Human Endogenous Metabolite |
| | gamma-Glu-epsilon-Lys Preparation Products And Raw materials |
|