- 6-NITRO BENZOXAZOLINONE
-
- $0.01 / 1KG
-
2020-01-08
- CAS:4694-91-1
- Min. Order: 1KG
- Purity: 98%;99%
- Supply Ability: 1kg; 5kg;10kg;25kg
|
| | 6-NITRO BENZOXAZOLINONE Basic information |
| | 6-NITRO BENZOXAZOLINONE Chemical Properties |
| Melting point | 248-252 °C(lit.) | | density | 1.580±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 7.89±0.70(Predicted) | | form | Powder or Needles | | color | White to off-white | | InChI | 1S/C7H4N2O4/c10-7-8-5-2-1-4(9(11)12)3-6(5)13-7/h1-3H,(H,8,10) | | InChIKey | JGYJZHYTADCWIK-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc2NC(=O)Oc2c1 | | CAS DataBase Reference | 4694-91-1(CAS DataBase Reference) | | EPA Substance Registry System | 2(3H)-Benzoxazolone, 6-nitro- (4694-91-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6-NITRO BENZOXAZOLINONE Usage And Synthesis |
| | 6-NITRO BENZOXAZOLINONE Preparation Products And Raw materials |
|