| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
N-(gamma-L-Glutamyl)-alpha-naphthylamide monohydrate manufacturers
|
| | N-(gamma-L-Glutamyl)-alpha-naphthylamide monohydrate Basic information |
| | N-(gamma-L-Glutamyl)-alpha-naphthylamide monohydrate Chemical Properties |
| storage temp. | -20°C | | solubility | 1 N NaOH: ethanol (1:1): 50mg/mL, clear, colorless to orange | | form | powder | | InChI | InChI=1/C15H16N2O3.H2O/c16-12(15(19)20)8-9-14(18)17-13-7-3-5-10-4-1-2-6-11(10)13;/h1-7,12H,8-9,16H2,(H,17,18)(H,19,20);1H2/t12-;/s3 | | InChIKey | QJIBNSSNADIAKZ-ZLBVLXFENA-N | | SMILES | N(C1=CC=CC2=CC=CC=C12)C(=O)CC[C@H](N)C(=O)O.O |&1:15,r| |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | N-(gamma-L-Glutamyl)-alpha-naphthylamide monohydrate Usage And Synthesis |
| Chemical Properties | white to slightly pink-brown crystalline powder | | Uses | L-Glutamic acid gamma-(alpha-naphthylamide) monohydrate |
| | N-(gamma-L-Glutamyl)-alpha-naphthylamide monohydrate Preparation Products And Raw materials |
|