| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Tetrahexylammonium hexafluorophosphate Basic information |
| Product Name: | Tetrahexylammonium hexafluorophosphate | | Synonyms: | Tetrahexylammonium hexafluorophosphate purum, >=97.0% (gravimetric);Tetrahexylammonium hexafluorophosphate >=97.0% (gravimetric);etrahexylazanium,hexafluorophosphate;Tetrahexylammonium hexafluorophosphate | | CAS: | 109241-90-9 | | MF: | C24H52F6NP | | MW: | 499.64 | | EINECS: | | | Product Categories: | | | Mol File: | 109241-90-9.mol |  |
| | Tetrahexylammonium hexafluorophosphate Chemical Properties |
| Melting point | 135-138 °C | | form | powder | | InChI | 1S/C24H52N.F6P/c1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;1-7(2,3,4,5)6/h5-24H2,1-4H3;/q+1;-1 | | InChIKey | KWQQUBRLECVPFD-UHFFFAOYSA-N | | SMILES | F[P-](F)(F)(F)(F)F.CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetrahexylammonium hexafluorophosphate Usage And Synthesis |
| | Tetrahexylammonium hexafluorophosphate Preparation Products And Raw materials |
|