| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Infinity SCI |
| Tel: |
400-106-2016 17800804092 |
| Email: |
admin@infsci.com |
| Company Name: |
Domole Scientific |
| Tel: |
13275595566; 13275595566 |
| Email: |
domole@infsci.com |
|
| | Chlorodimethyl(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)silane Basic information |
| Product Name: | Chlorodimethyl(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)silane | | Synonyms: | chlorodimethyl(2,3,4,5-tetramethyl-2,4-cyclopenta;ChlorodiMethyl(2,3,4,5-tetraMethyl-2,4-cyclopentadien-1-yl)silane 97%;1,3-Cyclopentadiene, 5-(chlorodimethylsilyl)-1,2,3,4-tetramethyl-;Chlorodimethyl(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane;Chlorodimethyl(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)silane | | CAS: | 125542-03-2 | | MF: | C11H19ClSi | | MW: | 214.81 | | EINECS: | | | Product Categories: | Protecting and Derivatizing Reagents;Protection and Derivatization;Silicon-Based | | Mol File: | 125542-03-2.mol |  |
| | Chlorodimethyl(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)silane Chemical Properties |
| Boiling point | 50 °C0.05 mm Hg(lit.) | | density | 0.972 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.496(lit.) | | Fp | 133 °F | | InChI | 1S/C11H19ClSi/c1-7-8(2)10(4)11(9(7)3)13(5,6)12/h11H,1-6H3 | | InChIKey | QTMBNCMQGRJAAA-UHFFFAOYSA-N | | SMILES | CC1=C(C)C(C)=C(C)C1[Si](C)(C)Cl |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 2986 8/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3
Skin Corr. 1B |
| | Chlorodimethyl(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)silane Usage And Synthesis |
| Uses | Chlorodimethyl(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane is used in the preparation of organometallic catalysts on silica supports. |
| | Chlorodimethyl(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)silane Preparation Products And Raw materials |
|