| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Benzyldimethylphenylammonium chloride manufacturers
|
| | Benzyldimethylphenylammonium chloride Basic information |
| | Benzyldimethylphenylammonium chloride Chemical Properties |
| Melting point | 134-138°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Methanol; Water | | form | powder to crystal | | color | White to Almost white | | Water Solubility | almost transparency | | InChI | InChI=1S/C15H18N.ClH/c1-16(2,15-11-7-4-8-12-15)13-14-9-5-3-6-10-14;/h3-12H,13H2,1-2H3;1H/q+1;/p-1 | | InChIKey | QLRKASHXFNIPLZ-UHFFFAOYSA-M | | SMILES | C1(=CC=CC=C1)C[N+](C)(C)C1=CC=CC=C1.[Cl-] | | EPA Substance Registry System | Benzenemethanaminium, N,N-dimethyl-N-phenyl-, chloride (3204-68-0) |
| | Benzyldimethylphenylammonium chloride Usage And Synthesis |
| Chemical Properties | White to off-white or ivory powder | | Uses | Benzyldimethylanilinium Chloride is an intermediate in synthesizing 5-Hydroxy-6-methyl-3,4-pyridinedicarboxylic Acid (H946970), which is used in studies to identify 4-pyridoxic acid dehydrogenase gene in pyridoxine catabolism of Mesorhizobium loti MAFF303099. |
| | Benzyldimethylphenylammonium chloride Preparation Products And Raw materials |
|